C14H22N2O4 — CID 123820730
tert-butyl 4-(cyclopenten-1-ylmethyl)-3-hydroxy-2-methoxydiazete-1-carboxylate (PubChem CID 123820730) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 4-(cyclopenten-1-ylmethyl)-3-hydroxy-2-methoxydiazete-1-carboxylate.
| Compound Name | tert-butyl 4-(cyclopenten-1-ylmethyl)-3-hydroxy-2-methoxydiazete-1-carboxylate |
|---|---|
| PubChem CID | 123820730 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl 4-(cyclopenten-1-ylmethyl)-3-hydroxy-2-methoxydiazete-1-carboxylate |
| SMILES | COn1c(O)c(CC2=CCCC2)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(18)15-11(12(17)16(15)19-4)9-10-7-5-6-8-10/h7,17H,5-6,8-9H2,1-4H3 |
| InChIKey | VHNSPJSFOQEIJR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|