C14H22N2O4 — CID 130394628
tert-butyl (4S)-4-(cyclopenten-1-ylmethyl)-2-methoxy-3-oxodiazetidine-1-carboxylate (PubChem CID 130394628) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl (4S)-4-(cyclopenten-1-ylmethyl)-2-methoxy-3-oxodiazetidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-(cyclopenten-1-ylmethyl)-2-methoxy-3-oxodiazetidine-1-carboxylate |
|---|---|
| PubChem CID | 130394628 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl (4S)-4-(cyclopenten-1-ylmethyl)-2-methoxy-3-oxodiazetidine-1-carboxylate |
| SMILES | CON1C(=O)[C@H](CC2=CCCC2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(18)15-11(12(17)16(15)19-4)9-10-7-5-6-8-10/h7,11H,5-6,8-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | HJOQSRSNFUDEGA-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|