C13H21N3O5 — CID 130394429
tert-butyl (4S)-2-methoxy-3-oxo-4-[(2-oxopyrrolidin-3-yl)methyl]diazetidine-1-carboxylate (PubChem CID 130394429) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is tert-butyl (4S)-2-methoxy-3-oxo-4-[(2-oxopyrrolidin-3-yl)methyl]diazetidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-2-methoxy-3-oxo-4-[(2-oxopyrrolidin-3-yl)methyl]diazetidine-1-carboxylate |
|---|---|
| PubChem CID | 130394429 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | tert-butyl (4S)-2-methoxy-3-oxo-4-[(2-oxopyrrolidin-3-yl)methyl]diazetidine-1-carboxylate |
| SMILES | CON1C(=O)[C@H](CC2CCNC2=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21N3O5/c1-13(2,3)21-12(19)15-9(11(18)16(15)20-4)7-8-5-6-14-10(8)17/h8-9H,5-7H2,1-4H3,(H,14,17)/t8?,9-/m0/s1 |
| InChIKey | CCRFFYSOLWKZEO-GKAPJAKFSA-N |
| XLogP | 0.44 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |