C18H26FNO2 — CID 123822781
[1-(2-fluorophenyl)-1-methoxypropan-2-yl] N-(3-methylcyclopentyl)ethanimidate (PubChem CID 123822781) has the molecular formula C18H26FNO2 and a molecular weight of 307.41 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-1-methoxypropan-2-yl] N-(3-methylcyclopentyl)ethanimidate.
| Compound Name | [1-(2-fluorophenyl)-1-methoxypropan-2-yl] N-(3-methylcyclopentyl)ethanimidate |
|---|---|
| PubChem CID | 123822781 |
| Molecular Formula | C18H26FNO2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | [1-(2-fluorophenyl)-1-methoxypropan-2-yl] N-(3-methylcyclopentyl)ethanimidate |
| SMILES | COC(c1ccccc1F)C(C)O/C(C)=N/C1CCC(C)C1 |
| InChI | InChI=1S/C18H26FNO2/c1-12-9-10-15(11-12)20-14(3)22-13(2)18(21-4)16-7-5-6-8-17(16)19/h5-8,12-13,15,18H,9-11H2,1-4H3/b20-14+ |
| InChIKey | OTJCQXOLAAXSQM-XSFVSMFZSA-N |
| XLogP | 4.53 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|