C6H18N4 — CID 123822875
2-[1-(2,2-dimethylhydrazinyl)ethyl]-1,1-dimethylhydrazine (PubChem CID 123822875) has the molecular formula C6H18N4 and a molecular weight of 146.24 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylhydrazinyl)ethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[1-(2,2-dimethylhydrazinyl)ethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 123822875 |
| Molecular Formula | C6H18N4 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 2-[1-(2,2-dimethylhydrazinyl)ethyl]-1,1-dimethylhydrazine |
| SMILES | CC(NN(C)C)NN(C)C |
| InChI | InChI=1S/C6H18N4/c1-6(7-9(2)3)8-10(4)5/h6-8H,1-5H3 |
| InChIKey | YVTNCHKIXMAVBP-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|