C22H18F2N2O — CID 123824442
5-(2,3-difluorophenyl)-3-prop-1-en-2-yl-2-(1-pyridin-3-ylethylideneamino)phenol (PubChem CID 123824442) has the molecular formula C22H18F2N2O and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-3-prop-1-en-2-yl-2-(1-pyridin-3-ylethylideneamino)phenol.
| Compound Name | 5-(2,3-difluorophenyl)-3-prop-1-en-2-yl-2-(1-pyridin-3-ylethylideneamino)phenol |
|---|---|
| PubChem CID | 123824442 |
| Molecular Formula | C22H18F2N2O |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-(2,3-difluorophenyl)-3-prop-1-en-2-yl-2-(1-pyridin-3-ylethylideneamino)phenol |
| SMILES | C=C(C)c1cc(-c2cccc(F)c2F)cc(O)c1/N=C(\C)c1cccnc1 |
| InChI | InChI=1S/C22H18F2N2O/c1-13(2)18-10-16(17-7-4-8-19(23)21(17)24)11-20(27)22(18)26-14(3)15-6-5-9-25-12-15/h4-12,27H,1H2,2-3H3/b26-14+ |
| InChIKey | MZCCGHAFXYHKPU-VULFUBBASA-N |
| XLogP | 5.91 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|