C33H36O12 — CID 123825162
5,16-bis[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-10-oxatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaen-11-one (PubChem CID 123825162) has the molecular formula C33H36O12 and a molecular weight of 624.64 g/mol. Its IUPAC name is 5,16-bis[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-10-oxatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaen-11-one.
| Compound Name | 5,16-bis[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-10-oxatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaen-11-one |
|---|---|
| PubChem CID | 123825162 |
| Molecular Formula | C33H36O12 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | 5,16-bis[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-10-oxatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaen-11-one |
| SMILES | O=C1CCc2cc(C#CC3OC(CO)C(O)C(O)C3O)ccc2-c2ccc(C#CC3OC(CO)C(O)C(O)C3O)cc2CCO1 |
| InChI | InChI=1S/C33H36O12/c34-15-25-30(39)32(41)28(37)23(44-25)8-3-17-1-6-21-19(13-17)5-10-27(36)43-12-11-20-14-18(2-7-22(20)21)4-9-24-29(38)33(42)31(40)26(16-35)45-24/h1-2,6-7,13-14,23-26,28-35,37-42H,5,10-12,15-16H2 |
| InChIKey | GOOSOAPHONDETC-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 206.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|