C32H45F6NO7S3 — CID 123825894
1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(4-methyl-1,4-oxathian-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid (PubChem CID 123825894) has the molecular formula C32H45F6NO7S3 and a molecular weight of 765.90 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(4-methyl-1,4-oxathian-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(4-methyl-1,4-oxathian-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123825894 |
| Molecular Formula | C32H45F6NO7S3 |
| Molecular Weight | 765.90 g/mol |
| Exact Mass | 765.23 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(4-methyl-1,4-oxathian-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid |
| SMILES | CC(C(=O)c1ccc(C2CCCC(C3CCCC4CN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CCC43)C2)cc1)S1(C)CCOCC1 |
| InChI | InChI=1S/C32H45F6NO7S3/c1-21(47(2)17-15-46-16-18-47)29(40)23-11-9-22(10-12-23)24-5-3-6-25(19-24)27-8-4-7-26-20-39(14-13-28(26)27)48(41,42)31(35,36)30(33,34)32(37,38)49(43,44)45/h9-12,21,24-28H,3-8,13-20H2,1-2H3,(H,43,44,45) |
| InChIKey | AQDOZOYRGUZXRX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.90 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|