C31H42F6NO7S3+ — CID 162572735
1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid (PubChem CID 162572735) has the molecular formula C31H42F6NO7S3+ and a molecular weight of 750.87 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 162572735 |
| Molecular Formula | C31H42F6NO7S3+ |
| Molecular Weight | 750.87 g/mol |
| Exact Mass | 750.20 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[[5-[3-[4-[2-(1,4-oxathian-4-ium-4-yl)propanoyl]phenyl]cyclohexyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid |
| SMILES | CC(C(=O)c1ccc(C2CCCC(C3CCCC4CN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CCC43)C2)cc1)[S+]1CCOCC1 |
| InChI | InChI=1S/C31H41F6NO7S3/c1-20(46-16-14-45-15-17-46)28(39)22-10-8-21(9-11-22)23-4-2-5-24(18-23)26-7-3-6-25-19-38(13-12-27(25)26)47(40,41)30(34,35)29(32,33)31(36,37)48(42,43)44/h8-11,20,23-27H,2-7,12-19H2,1H3/p+1 |
| InChIKey | PIXOQHASMOYVCQ-UHFFFAOYSA-O |
| XLogP | 5.96 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.87 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|