C19H23N3O3 — CID 123826019
N-hydroxy-2-oxo-8-[4-(pyridin-2-ylamino)phenyl]octanamide (PubChem CID 123826019) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-hydroxy-2-oxo-8-[4-(pyridin-2-ylamino)phenyl]octanamide.
| Compound Name | N-hydroxy-2-oxo-8-[4-(pyridin-2-ylamino)phenyl]octanamide |
|---|---|
| PubChem CID | 123826019 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-hydroxy-2-oxo-8-[4-(pyridin-2-ylamino)phenyl]octanamide |
| SMILES | O=C(CCCCCCc1ccc(Nc2ccccn2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H23N3O3/c23-17(19(24)22-25)8-4-2-1-3-7-15-10-12-16(13-11-15)21-18-9-5-6-14-20-18/h5-6,9-14,25H,1-4,7-8H2,(H,20,21)(H,22,24) |
| InChIKey | USAZZGHPHBPPBO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|