C12H17F9N2O6S3 — CID 123826652
3-[1-(azepan-4-yl)ethylsulfonyl]-1,1,2,2,3,3-hexafluoro-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 123826652) has the molecular formula C12H17F9N2O6S3 and a molecular weight of 552.46 g/mol. Its IUPAC name is 3-[1-(azepan-4-yl)ethylsulfonyl]-1,1,2,2,3,3-hexafluoro-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 3-[1-(azepan-4-yl)ethylsulfonyl]-1,1,2,2,3,3-hexafluoro-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 123826652 |
| Molecular Formula | C12H17F9N2O6S3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | 3-[1-(azepan-4-yl)ethylsulfonyl]-1,1,2,2,3,3-hexafluoro-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | CC(C1CCCNCC1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H17F9N2O6S3/c1-7(8-3-2-5-22-6-4-8)30(24,25)10(15,16)9(13,14)11(17,18)31(26,27)23-32(28,29)12(19,20)21/h7-8,22-23H,2-6H2,1H3 |
| InChIKey | VSKKQNIOGMXFOJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|