C16H24F9NO6S3 — CID 123923134
4-[1-[1,1,2,2,3,3-hexafluoro-3-[3-(trifluoromethylsulfonyl)butylsulfonyl]propyl]sulfonylethyl]azepane (PubChem CID 123923134) has the molecular formula C16H24F9NO6S3 and a molecular weight of 593.55 g/mol. Its IUPAC name is 4-[1-[1,1,2,2,3,3-hexafluoro-3-[3-(trifluoromethylsulfonyl)butylsulfonyl]propyl]sulfonylethyl]azepane.
| Compound Name | 4-[1-[1,1,2,2,3,3-hexafluoro-3-[3-(trifluoromethylsulfonyl)butylsulfonyl]propyl]sulfonylethyl]azepane |
|---|---|
| PubChem CID | 123923134 |
| Molecular Formula | C16H24F9NO6S3 |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 593.06 |
| IUPAC Name | 4-[1-[1,1,2,2,3,3-hexafluoro-3-[3-(trifluoromethylsulfonyl)butylsulfonyl]propyl]sulfonylethyl]azepane |
| SMILES | CC(CCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)C(C)C1CCCNCC1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H24F9NO6S3/c1-10(34(29,30)16(23,24)25)6-9-33(27,28)14(19,20)13(17,18)15(21,22)35(31,32)11(2)12-4-3-7-26-8-5-12/h10-12,26H,3-9H2,1-2H3 |
| InChIKey | UGIGOMXORGJDTQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|