C18H28F9NO6S3 — CID 91438526
4-[1-[1,1,2,2,3,3-hexafluoro-3-[4-(trifluoromethylsulfonyl)pentylsulfonyl]propyl]sulfonylethyl]-1-methylazepane (PubChem CID 91438526) has the molecular formula C18H28F9NO6S3 and a molecular weight of 621.61 g/mol. Its IUPAC name is 4-[1-[1,1,2,2,3,3-hexafluoro-3-[4-(trifluoromethylsulfonyl)pentylsulfonyl]propyl]sulfonylethyl]-1-methylazepane.
| Compound Name | 4-[1-[1,1,2,2,3,3-hexafluoro-3-[4-(trifluoromethylsulfonyl)pentylsulfonyl]propyl]sulfonylethyl]-1-methylazepane |
|---|---|
| PubChem CID | 91438526 |
| Molecular Formula | C18H28F9NO6S3 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | 4-[1-[1,1,2,2,3,3-hexafluoro-3-[4-(trifluoromethylsulfonyl)pentylsulfonyl]propyl]sulfonylethyl]-1-methylazepane |
| SMILES | CC(CCCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)C(C)C1CCCN(C)CC1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H28F9NO6S3/c1-12(36(31,32)18(25,26)27)6-5-11-35(29,30)16(21,22)15(19,20)17(23,24)37(33,34)13(2)14-7-4-9-28(3)10-8-14/h12-14H,4-11H2,1-3H3 |
| InChIKey | HKLKYMAMLXDOHC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|