C14H22FNO6 — CID 123827269
2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioic acid (PubChem CID 123827269) has the molecular formula C14H22FNO6 and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioic acid.
| Compound Name | 2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioic acid |
|---|---|
| PubChem CID | 123827269 |
| Molecular Formula | C14H22FNO6 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC=C(CCCF)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22FNO6/c1-14(2,3)22-13(21)16-10(12(19)20)7-6-9(11(17)18)5-4-8-15/h6,10H,4-5,7-8H2,1-3H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | QDNASCKEYRXYOD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|