C20H34FNO6 — CID 86678427
6-O-tert-butyl 1-O-ethyl (E,5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioate (PubChem CID 86678427) has the molecular formula C20H34FNO6 and a molecular weight of 403.49 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-ethyl (E,5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioate.
| Compound Name | 6-O-tert-butyl 1-O-ethyl (E,5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioate |
|---|---|
| PubChem CID | 86678427 |
| Molecular Formula | C20H34FNO6 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 6-O-tert-butyl 1-O-ethyl (E,5S)-2-(3-fluoropropyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enedioate |
| SMILES | CCOC(=O)/C(=C/C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CCCF |
| InChI | InChI=1S/C20H34FNO6/c1-8-26-16(23)14(10-9-13-21)11-12-15(17(24)27-19(2,3)4)22-18(25)28-20(5,6)7/h11,15H,8-10,12-13H2,1-7H3,(H,22,25)/b14-11+/t15-/m0/s1 |
| InChIKey | ZHWYWXJTWYDEHP-GOFCXVBSSA-N |
| XLogP | 3.85 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|