C6H16O3SSi — CID 123832327
1-[methoxy(3-sulfanylpropyl)silyl]ethane-1,2-diol (PubChem CID 123832327) has the molecular formula C6H16O3SSi and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-[methoxy(3-sulfanylpropyl)silyl]ethane-1,2-diol.
| Compound Name | 1-[methoxy(3-sulfanylpropyl)silyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 123832327 |
| Molecular Formula | C6H16O3SSi |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 1-[methoxy(3-sulfanylpropyl)silyl]ethane-1,2-diol |
| SMILES | CO[SiH](CCCS)C(O)CO |
| InChI | InChI=1S/C6H16O3SSi/c1-9-11(4-2-3-10)6(8)5-7/h6-8,10-11H,2-5H2,1H3 |
| InChIKey | BUISZEWGABNAAB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|