C15H32O4S — CID 134417180
2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol (PubChem CID 134417180) has the molecular formula C15H32O4S and a molecular weight of 308.48 g/mol. Its IUPAC name is 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol.
| Compound Name | 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol |
|---|---|
| PubChem CID | 134417180 |
| Molecular Formula | C15H32O4S |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol |
| SMILES | OCC(CO)CCCC(CCS)CCCC(CO)CO |
| InChI | InChI=1S/C15H32O4S/c16-9-14(10-17)5-1-3-13(7-8-20)4-2-6-15(11-18)12-19/h13-20H,1-12H2 |
| InChIKey | PAXBWDYIJKRCJS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|