About 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol
2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol (PubChem CID 134417180) has the molecular formula C15H32O4S
and a molecular weight of 308.48 g/mol. Its IUPAC name is 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol.
Molecular Properties
| Compound Name | 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol |
| PubChem CID | 134417180 |
| Molecular Formula | C15H32O4S |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol |
| SMILES | OCC(CO)CCCC(CCS)CCCC(CO)CO |
| InChI | InChI=1S/C15H32O4S/c16-9-14(10-17)5-1-3-13(7-8-20)4-2-6-15(11-18)12-19/h13-20H,1-12H2 |
| InChIKey | PAXBWDYIJKRCJS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol?
The IUPAC name of 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol (CID 134417180) is 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol.
What is the SMILES notation for 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol?
The canonical SMILES for 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol is OCC(CO)CCCC(CCS)CCCC(CO)CO.
What is the InChIKey of 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol?
The InChIKey is PAXBWDYIJKRCJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O4S/c16-9-14(10-17)5-1-3-13(7-8-20)4-2-6-15(11-18)12-19/h13-20H,1-12H2.
What are the key properties of 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol?
2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol has a molecular weight of 308.48 g/mol, XLogP of 1.46, 14 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-bis(hydroxymethyl)-6-(2-sulfanylethyl)undecane-1,11-diol is sourced from PubChem (CID 134417180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).