C8H10N2S — CID 123833142
cyclohepta-1,4,6-trien-1-ylthiourea (PubChem CID 123833142) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is cyclohepta-1,4,6-trien-1-ylthiourea.
| Compound Name | cyclohepta-1,4,6-trien-1-ylthiourea |
|---|---|
| PubChem CID | 123833142 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | cyclohepta-1,4,6-trien-1-ylthiourea |
| SMILES | NC(=S)NC1=CCC=CC=C1 |
| InChI | InChI=1S/C8H10N2S/c9-8(11)10-7-5-3-1-2-4-6-7/h1-3,5-6H,4H2,(H3,9,10,11) |
| InChIKey | RGPTTWKDGMYFRD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|