C8H12N2S — CID 143184467
[(3E)-5-methylhexa-1,3,5-trien-3-yl]thiourea (PubChem CID 143184467) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is [(3E)-5-methylhexa-1,3,5-trien-3-yl]thiourea.
| Compound Name | [(3E)-5-methylhexa-1,3,5-trien-3-yl]thiourea |
|---|---|
| PubChem CID | 143184467 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | [(3E)-5-methylhexa-1,3,5-trien-3-yl]thiourea |
| SMILES | C=C/C(=C\C(=C)C)NC(N)=S |
| InChI | InChI=1S/C8H12N2S/c1-4-7(5-6(2)3)10-8(9)11/h4-5H,1-2H2,3H3,(H3,9,10,11)/b7-5+ |
| InChIKey | ZLJYNCMWGDTFQF-FNORWQNLSA-N |
| XLogP | 1.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|