About [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea
[(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea (PubChem CID 130193513) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea.
Molecular Properties
| Compound Name | [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea |
| PubChem CID | 130193513 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea |
| SMILES | CC/C=C(C)\C(=C/CC)NC(N)=S |
| InChI | InChI=1S/C10H18N2S/c1-4-6-8(3)9(7-5-2)12-10(11)13/h6-7H,4-5H2,1-3H3,(H3,11,12,13)/b8-6-,9-7+ |
| InChIKey | SYFSMJFKUGJLLW-MKKAVFGOSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea?
The IUPAC name of [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea (CID 130193513) is [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea.
What is the SMILES notation for [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea?
The canonical SMILES for [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea is CC/C=C(C)\C(=C/CC)NC(N)=S.
What is the InChIKey of [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea?
The InChIKey is SYFSMJFKUGJLLW-MKKAVFGOSA-N. The full InChI is InChI=1S/C10H18N2S/c1-4-6-8(3)9(7-5-2)12-10(11)13/h6-7H,4-5H2,1-3H3,(H3,11,12,13)/b8-6-,9-7+.
What are the key properties of [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea?
[(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea has a molecular weight of 198.33 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E,5Z)-5-methylocta-3,5-dien-4-yl]thiourea is sourced from PubChem (CID 130193513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).