C14H13N5O — CID 123833221
N-[4-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)phenyl]acetamide (PubChem CID 123833221) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[4-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)phenyl]acetamide.
| Compound Name | N-[4-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 123833221 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[4-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2n[nH]c3cccnc23)cc1 |
| InChI | InChI=1S/C14H13N5O/c1-9(20)16-10-4-6-11(7-5-10)17-14-13-12(18-19-14)3-2-8-15-13/h2-8H,1H3,(H,16,20)(H2,17,18,19) |
| InChIKey | PGUBPTGWGVOJTN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |