About 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea
1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea (PubChem CID 53373996) has the molecular formula C14H12FN5O
and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea.
Molecular Properties
| Compound Name | 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea |
| PubChem CID | 53373996 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2n[nH]c3cccnc23)ccc1F |
| InChI | InChI=1S/C14H12FN5O/c1-8-7-9(4-5-10(8)15)17-14(21)18-13-12-11(19-20-13)3-2-6-16-12/h2-7H,1H3,(H3,17,18,19,20,21) |
| InChIKey | QUEHFHZVAWHGCG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea?
The IUPAC name of 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea (CID 53373996) is 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea.
What is the SMILES notation for 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea?
The canonical SMILES for 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea is Cc1cc(NC(=O)Nc2n[nH]c3cccnc23)ccc1F.
What is the InChIKey of 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea?
The InChIKey is QUEHFHZVAWHGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN5O/c1-8-7-9(4-5-10(8)15)17-14(21)18-13-12-11(19-20-13)3-2-6-16-12/h2-7H,1H3,(H3,17,18,19,20,21).
What are the key properties of 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea?
1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea has a molecular weight of 285.28 g/mol, XLogP of 3.05, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-3-methylphenyl)-3-(1H-pyrazolo[4,3-b]pyridin-3-yl)urea is sourced from PubChem (CID 53373996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).