C23H25NO — CID 123837430
N,N-diethyl-2-methyl-5-(6-methylnaphthalen-2-yl)benzamide (PubChem CID 123837430) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is N,N-diethyl-2-methyl-5-(6-methylnaphthalen-2-yl)benzamide.
| Compound Name | N,N-diethyl-2-methyl-5-(6-methylnaphthalen-2-yl)benzamide |
|---|---|
| PubChem CID | 123837430 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N,N-diethyl-2-methyl-5-(6-methylnaphthalen-2-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1cc(-c2ccc3cc(C)ccc3c2)ccc1C |
| InChI | InChI=1S/C23H25NO/c1-5-24(6-2)23(25)22-15-21(10-8-17(22)4)20-12-11-18-13-16(3)7-9-19(18)14-20/h7-15H,5-6H2,1-4H3 |
| InChIKey | IIQKXSHXHORFBD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |