About 6-amino-4,5-dihydro-2H-pyridin-3-one
6-amino-4,5-dihydro-2H-pyridin-3-one (PubChem CID 123839100) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 6-amino-4,5-dihydro-2H-pyridin-3-one.
Molecular Properties
| Compound Name | 6-amino-4,5-dihydro-2H-pyridin-3-one |
| PubChem CID | 123839100 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 6-amino-4,5-dihydro-2H-pyridin-3-one |
| SMILES | NC1=NCC(=O)CC1 |
| InChI | InChI=1S/C5H8N2O/c6-5-2-1-4(8)3-7-5/h1-3H2,(H2,6,7) |
| InChIKey | HQAMBUSNFNCHJH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-4,5-dihydro-2H-pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4,5-dihydro-2H-pyridin-3-one?
The IUPAC name of 6-amino-4,5-dihydro-2H-pyridin-3-one (CID 123839100) is 6-amino-4,5-dihydro-2H-pyridin-3-one.
What is the SMILES notation for 6-amino-4,5-dihydro-2H-pyridin-3-one?
The canonical SMILES for 6-amino-4,5-dihydro-2H-pyridin-3-one is NC1=NCC(=O)CC1.
What is the InChIKey of 6-amino-4,5-dihydro-2H-pyridin-3-one?
The InChIKey is HQAMBUSNFNCHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c6-5-2-1-4(8)3-7-5/h1-3H2,(H2,6,7).
What are the key properties of 6-amino-4,5-dihydro-2H-pyridin-3-one?
6-amino-4,5-dihydro-2H-pyridin-3-one has a molecular weight of 112.13 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,5-dihydro-2H-pyridin-3-one is sourced from PubChem (CID 123839100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).