C25H21N4O+ — CID 123839800
1-cyclopentyl-4-(8-quinolin-4-yl-7-aza-1-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-yl)pyridin-2-one (PubChem CID 123839800) has the molecular formula C25H21N4O+ and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-cyclopentyl-4-(8-quinolin-4-yl-7-aza-1-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-yl)pyridin-2-one.
| Compound Name | 1-cyclopentyl-4-(8-quinolin-4-yl-7-aza-1-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 123839800 |
| Molecular Formula | C25H21N4O+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-cyclopentyl-4-(8-quinolin-4-yl-7-aza-1-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-yl)pyridin-2-one |
| SMILES | O=c1cc(-c2cc[n+]3c(c2)=NC=3c2ccnc3ccccc23)ccn1C1CCCC1 |
| InChI | InChI=1S/C25H21N4O/c30-24-16-18(10-13-28(24)19-5-1-2-6-19)17-11-14-29-23(15-17)27-25(29)21-9-12-26-22-8-4-3-7-20(21)22/h3-4,7-16,19H,1-2,5-6H2/q+1 |
| InChIKey | LSTJGJVNNFEREO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|