About 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide
3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (PubChem CID 171974601) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
Molecular Properties
| Compound Name | 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| PubChem CID | 171974601 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| SMILES | O=S1C2C=C(c3ccnc4ccccc34)CC1CCC2 |
| InChI | InChI=1S/C17H17NOS/c19-20-13-4-3-5-14(20)11-12(10-13)15-8-9-18-17-7-2-1-6-16(15)17/h1-2,6-10,13-14H,3-5,11H2 |
| InChIKey | OOKWBLOAFHRADS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The IUPAC name of 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (CID 171974601) is 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
What is the SMILES notation for 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The canonical SMILES for 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide is O=S1C2C=C(c3ccnc4ccccc34)CC1CCC2.
What is the InChIKey of 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The InChIKey is OOKWBLOAFHRADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c19-20-13-4-3-5-14(20)11-12(10-13)15-8-9-18-17-7-2-1-6-16(15)17/h1-2,6-10,13-14H,3-5,11H2.
What are the key properties of 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide has a molecular weight of 283.40 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-quinolin-4-yl-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide is sourced from PubChem (CID 171974601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).