About 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide
3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (PubChem CID 171974488) has the molecular formula C15H14F2O3S
and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
Molecular Properties
| Compound Name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| PubChem CID | 171974488 |
| Molecular Formula | C15H14F2O3S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| SMILES | O=S1C2C=C(c3ccc4c(c3)OC(F)(F)O4)CC1CCC2 |
| InChI | InChI=1S/C15H14F2O3S/c16-15(17)19-13-5-4-9(8-14(13)20-15)10-6-11-2-1-3-12(7-10)21(11)18/h4-6,8,11-12H,1-3,7H2 |
| InChIKey | TUYDPMDVGUBROI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The IUPAC name of 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (CID 171974488) is 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
What is the SMILES notation for 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The canonical SMILES for 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide is O=S1C2C=C(c3ccc4c(c3)OC(F)(F)O4)CC1CCC2.
What is the InChIKey of 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The InChIKey is TUYDPMDVGUBROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2O3S/c16-15(17)19-13-5-4-9(8-14(13)20-15)10-6-11-2-1-3-12(7-10)21(11)18/h4-6,8,11-12H,1-3,7H2.
What are the key properties of 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide has a molecular weight of 312.34 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide is sourced from PubChem (CID 171974488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).