C15H15F3O2S — CID 171974178
3-[2-(trifluoromethoxy)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (PubChem CID 171974178) has the molecular formula C15H15F3O2S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[2-(trifluoromethoxy)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
| Compound Name | 3-[2-(trifluoromethoxy)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
|---|---|
| PubChem CID | 171974178 |
| Molecular Formula | C15H15F3O2S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[2-(trifluoromethoxy)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| SMILES | O=S1C2C=C(c3ccccc3OC(F)(F)F)CC1CCC2 |
| InChI | InChI=1S/C15H15F3O2S/c16-15(17,18)20-14-7-2-1-6-13(14)10-8-11-4-3-5-12(9-10)21(11)19/h1-2,6-8,11-12H,3-5,9H2 |
| InChIKey | CRFZEDMSRDUFFZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |