About 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine
2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine (PubChem CID 123840771) has the molecular formula C14H32N4
and a molecular weight of 256.44 g/mol. Its IUPAC name is 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine.
Molecular Properties
| Compound Name | 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine |
| PubChem CID | 123840771 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine |
| SMILES | CCC(CN)CN1CCNCCCNCCC1C |
| InChI | InChI=1S/C14H32N4/c1-3-14(11-15)12-18-10-9-17-7-4-6-16-8-5-13(18)2/h13-14,16-17H,3-12,15H2,1-2H3 |
| InChIKey | YBRYVHIYFXSZFW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine?
The IUPAC name of 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine (CID 123840771) is 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine.
What is the SMILES notation for 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine?
The canonical SMILES for 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine is CCC(CN)CN1CCNCCCNCCC1C.
What is the InChIKey of 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine?
The InChIKey is YBRYVHIYFXSZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N4/c1-3-14(11-15)12-18-10-9-17-7-4-6-16-8-5-13(18)2/h13-14,16-17H,3-12,15H2,1-2H3.
What are the key properties of 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine?
2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine has a molecular weight of 256.44 g/mol, XLogP of 0.63, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(11-methyl-1,4,8-triazacycloundec-1-yl)methyl]butan-1-amine is sourced from PubChem (CID 123840771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).