C18H16NS+ — CID 123840876
3,3-dimethyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene (PubChem CID 123840876) has the molecular formula C18H16NS+ and a molecular weight of 278.40 g/mol. Its IUPAC name is 3,3-dimethyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene.
| Compound Name | 3,3-dimethyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene |
|---|---|
| PubChem CID | 123840876 |
| Molecular Formula | C18H16NS+ |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3,3-dimethyl-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene |
| SMILES | CC1(C)C2c3c(sc4ccccc34)-c3cccc[n+]3C21 |
| InChI | InChI=1S/C18H16NS/c1-18(2)15-14-11-7-3-4-9-13(11)20-16(14)12-8-5-6-10-19(12)17(15)18/h3-10,15,17H,1-2H3/q+1 |
| InChIKey | AQUBZMQTGBVJAI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|