C29H34N4O3 — CID 123841058
2-[2,2-dimethyl-4-(2-methyl-1-benzofuran-3-carbonyl)piperazin-1-yl]-N'-[(E)-2-(3-methylphenyl)but-1-enyl]-2-oxoethanimidamide (PubChem CID 123841058) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[2,2-dimethyl-4-(2-methyl-1-benzofuran-3-carbonyl)piperazin-1-yl]-N'-[(E)-2-(3-methylphenyl)but-1-enyl]-2-oxoethanimidamide.
| Compound Name | 2-[2,2-dimethyl-4-(2-methyl-1-benzofuran-3-carbonyl)piperazin-1-yl]-N'-[(E)-2-(3-methylphenyl)but-1-enyl]-2-oxoethanimidamide |
|---|---|
| PubChem CID | 123841058 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[2,2-dimethyl-4-(2-methyl-1-benzofuran-3-carbonyl)piperazin-1-yl]-N'-[(E)-2-(3-methylphenyl)but-1-enyl]-2-oxoethanimidamide |
| SMILES | CC/C(=C\N=C(/N)C(=O)N1CCN(C(=O)c2c(C)oc3ccccc23)CC1(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C29H34N4O3/c1-6-21(22-11-9-10-19(2)16-22)17-31-26(30)28(35)33-15-14-32(18-29(33,4)5)27(34)25-20(3)36-24-13-8-7-12-23(24)25/h7-13,16-17H,6,14-15,18H2,1-5H3,(H2,30,31)/b21-17+ |
| InChIKey | CQVONEMKGXZZTQ-HEHNFIMWSA-N |
| XLogP | 4.92 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|