C11H19N2+ — CID 123841124
methyl-(methylideneamino)-(4-methylpenta-1,3-dien-3-yl)-prop-1-enylazanium (PubChem CID 123841124) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is methyl-(methylideneamino)-(4-methylpenta-1,3-dien-3-yl)-prop-1-enylazanium.
| Compound Name | methyl-(methylideneamino)-(4-methylpenta-1,3-dien-3-yl)-prop-1-enylazanium |
|---|---|
| PubChem CID | 123841124 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | methyl-(methylideneamino)-(4-methylpenta-1,3-dien-3-yl)-prop-1-enylazanium |
| SMILES | C=CC(=C(C)C)[N+](C)(C=CC)N=C |
| InChI | InChI=1S/C11H19N2/c1-7-9-13(6,12-5)11(8-2)10(3)4/h7-9H,2,5H2,1,3-4,6H3/q+1 |
| InChIKey | GRAATBGMYIIHMK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|