C10H18N2 — CID 143779928
ethane;N-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine (PubChem CID 143779928) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;N-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine.
| Compound Name | ethane;N-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143779928 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;N-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)N(/C=C\C)N=C.CC |
| InChI | InChI=1S/C8H12N2.C2H6/c1-5-7-10(9-4)8(3)6-2;1-2/h5-7H,2-4H2,1H3;1-2H3/b7-5-; |
| InChIKey | ZAISJTJFTGWWLT-YJOCEBFMSA-N |
| XLogP | 3.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|