C15H28N2 — CID 143636713
ethane;(3E,5Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-1,3,5-trien-4-amine (PubChem CID 143636713) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;(3E,5Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-1,3,5-trien-4-amine.
| Compound Name | ethane;(3E,5Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143636713 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;(3E,5Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(C=C)/N=C\C.CC.CC |
| InChI | InChI=1S/C11H16N2.2C2H6/c1-5-9-11(10-6-2)13(8-4)12-7-3;2*1-2/h5-10H,1,4H2,2-3H3;2*1-2H3/b10-6-,11-9+,12-7-;; |
| InChIKey | VMBNBXIIZWPUKB-GSFYCIPXSA-N |
| XLogP | 5.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|