C24H21N3O4 — CID 123841469
ethyl 8-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]-1,7-naphthyridine-6-carboxylate (PubChem CID 123841469) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is ethyl 8-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]-1,7-naphthyridine-6-carboxylate.
| Compound Name | ethyl 8-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]-1,7-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 123841469 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl 8-[3-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]-1,7-naphthyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cc2cccnc2c(-c2cccc(C#CC3(O)CCN(C)C3=O)c2)n1 |
| InChI | InChI=1S/C24H21N3O4/c1-3-31-22(28)19-15-18-8-5-12-25-20(18)21(26-19)17-7-4-6-16(14-17)9-10-24(30)11-13-27(2)23(24)29/h4-8,12,14-15,30H,3,11,13H2,1-2H3 |
| InChIKey | QECMVCKIBQNKEB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|