C37H39N6+ — CID 123842440
5',5'-diethyl-5-methyl-1'-(2,4,6-trimethylphenyl)spiro[5aH-purino[9,8-a]indole-6,7'-6H-imidazo[2,1-a][2]benzazepin-4-ium] (PubChem CID 123842440) has the molecular formula C37H39N6+ and a molecular weight of 567.76 g/mol. Its IUPAC name is 5',5'-diethyl-5-methyl-1'-(2,4,6-trimethylphenyl)spiro[5aH-purino[9,8-a]indole-6,7'-6H-imidazo[2,1-a][2]benzazepin-4-ium].
| Compound Name | 5',5'-diethyl-5-methyl-1'-(2,4,6-trimethylphenyl)spiro[5aH-purino[9,8-a]indole-6,7'-6H-imidazo[2,1-a][2]benzazepin-4-ium] |
|---|---|
| PubChem CID | 123842440 |
| Molecular Formula | C37H39N6+ |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 5',5'-diethyl-5-methyl-1'-(2,4,6-trimethylphenyl)spiro[5aH-purino[9,8-a]indole-6,7'-6H-imidazo[2,1-a][2]benzazepin-4-ium] |
| SMILES | CCC1(CC)CC2(c3ccccc3-c3n(-c4c(C)cc(C)cc4C)cc[n+]31)c1ccccc1N1c3ncncc3N(C)C12 |
| InChI | InChI=1S/C37H39N6/c1-7-36(8-2)22-37(29-15-11-12-16-30(29)43-33-31(21-38-23-39-33)40(6)35(37)43)28-14-10-9-13-27(28)34-41(17-18-42(34)36)32-25(4)19-24(3)20-26(32)5/h9-21,23,35H,7-8,22H2,1-6H3/q+1 |
| InChIKey | AQUACNUDJPPRIP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|