C15H24N3O2S2+ — CID 123842618
2-[(2-ethylidene-3-methyl-1,3-benzothiazol-6-yl)sulfonylamino]ethyl-trimethylazanium (PubChem CID 123842618) has the molecular formula C15H24N3O2S2+ and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[(2-ethylidene-3-methyl-1,3-benzothiazol-6-yl)sulfonylamino]ethyl-trimethylazanium.
| Compound Name | 2-[(2-ethylidene-3-methyl-1,3-benzothiazol-6-yl)sulfonylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 123842618 |
| Molecular Formula | C15H24N3O2S2+ |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[(2-ethylidene-3-methyl-1,3-benzothiazol-6-yl)sulfonylamino]ethyl-trimethylazanium |
| SMILES | CC=C1Sc2cc(S(=O)(=O)NCC[N+](C)(C)C)ccc2N1C |
| InChI | InChI=1S/C15H24N3O2S2/c1-6-15-17(2)13-8-7-12(11-14(13)21-15)22(19,20)16-9-10-18(3,4)5/h6-8,11,16H,9-10H2,1-5H3/q+1 |
| InChIKey | FKUVCJOFNZVWBG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|