C16H18N2O7S3 — CID 134554178
2-N,8-N-bis(2-hydroxyethyl)phenoxathiine-2,8-disulfonamide (PubChem CID 134554178) has the molecular formula C16H18N2O7S3 and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-N,8-N-bis(2-hydroxyethyl)phenoxathiine-2,8-disulfonamide.
| Compound Name | 2-N,8-N-bis(2-hydroxyethyl)phenoxathiine-2,8-disulfonamide |
|---|---|
| PubChem CID | 134554178 |
| Molecular Formula | C16H18N2O7S3 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2-N,8-N-bis(2-hydroxyethyl)phenoxathiine-2,8-disulfonamide |
| SMILES | O=S(=O)(NCCO)c1ccc2c(c1)Sc1cc(S(=O)(=O)NCCO)ccc1O2 |
| InChI | InChI=1S/C16H18N2O7S3/c19-7-5-17-27(21,22)11-1-3-13-15(9-11)26-16-10-12(2-4-14(16)25-13)28(23,24)18-6-8-20/h1-4,9-10,17-20H,5-8H2 |
| InChIKey | HVEKUUTXBOPBIT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |