C10H27N3Si — CID 123843903
1-N"-tert-butyl-1-N,1-N',2-trimethyl-2-silylpropane-1,1,1-triamine (PubChem CID 123843903) has the molecular formula C10H27N3Si and a molecular weight of 217.43 g/mol. Its IUPAC name is 1-N"-tert-butyl-1-N,1-N',2-trimethyl-2-silylpropane-1,1,1-triamine.
| Compound Name | 1-N"-tert-butyl-1-N,1-N',2-trimethyl-2-silylpropane-1,1,1-triamine |
|---|---|
| PubChem CID | 123843903 |
| Molecular Formula | C10H27N3Si |
| Molecular Weight | 217.43 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-N"-tert-butyl-1-N,1-N',2-trimethyl-2-silylpropane-1,1,1-triamine |
| SMILES | CNC(NC)(NC(C)(C)C)C(C)(C)[SiH3] |
| InChI | InChI=1S/C10H27N3Si/c1-8(2,3)13-10(11-6,12-7)9(4,5)14/h11-13H,1-7,14H3 |
| InChIKey | WYNXWGMLOAEYKU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|