C27H30N4O7 — CID 123844574
N-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-dihydroxy-4-methoxybutanamide (PubChem CID 123844574) has the molecular formula C27H30N4O7 and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-dihydroxy-4-methoxybutanamide.
| Compound Name | N-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-dihydroxy-4-methoxybutanamide |
|---|---|
| PubChem CID | 123844574 |
| Molecular Formula | C27H30N4O7 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | N-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-dihydroxy-4-methoxybutanamide |
| SMILES | COCC(O)C(O)C(=O)Nc1cccc2c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3C)c[nH]c12 |
| InChI | InChI=1S/C27H30N4O7/c1-16-14-30(26(36)17-7-4-3-5-8-17)11-12-31(16)27(37)23(33)19-13-28-22-18(19)9-6-10-20(22)29-25(35)24(34)21(32)15-38-2/h3-10,13,16,21,24,28,32,34H,11-12,14-15H2,1-2H3,(H,29,35) |
| InChIKey | MTPFRONRNZHGOP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 152.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|