C30H36N6O3 — CID 123405744
1-[3-[2-(4-benzoyl-2-ethenylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-di(propan-2-yl)guanidine (PubChem CID 123405744) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is 1-[3-[2-(4-benzoyl-2-ethenylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[3-[2-(4-benzoyl-2-ethenylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 123405744 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 1-[3-[2-(4-benzoyl-2-ethenylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-2,3-di(propan-2-yl)guanidine |
| SMILES | C=CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(N/C(=N/C(C)C)NC(C)C)cccc12 |
| InChI | InChI=1S/C30H36N6O3/c1-6-22-18-35(28(38)21-11-8-7-9-12-21)15-16-36(22)29(39)27(37)24-17-31-26-23(24)13-10-14-25(26)34-30(32-19(2)3)33-20(4)5/h6-14,17,19-20,22,31H,1,15-16,18H2,2-5H3,(H2,32,33,34) |
| InChIKey | HCECESCAEUXGQT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|