C36H41BN6O9 — CID 77404304
[3-[2-[2-[2-[[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoyl]phenyl]boronic acid (PubChem CID 77404304) has the molecular formula C36H41BN6O9 and a molecular weight of 712.57 g/mol. Its IUPAC name is [3-[2-[2-[2-[[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoyl]phenyl]boronic acid.
| Compound Name | [3-[2-[2-[2-[[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 77404304 |
| Molecular Formula | C36H41BN6O9 |
| Molecular Weight | 712.57 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | [3-[2-[2-[2-[[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoyl]phenyl]boronic acid |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(NC(=O)NCCOCCOCCNC(=O)c3cccc(B(O)O)c3)cccc12 |
| InChI | InChI=1S/C36H41BN6O9/c1-24-23-42(34(46)25-7-3-2-4-8-25)15-16-43(24)35(47)32(44)29-22-40-31-28(29)11-6-12-30(31)41-36(48)39-14-18-52-20-19-51-17-13-38-33(45)26-9-5-10-27(21-26)37(49)50/h2-12,21-22,24,40,49-50H,13-20,23H2,1H3,(H,38,45)(H2,39,41,48) |
| InChIKey | ROZLKNDJXIPNKU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 202.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.57 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|