C11H15N — CID 123844863
4-butyl-2,3-dimethylidenepyridine (PubChem CID 123844863) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 4-butyl-2,3-dimethylidenepyridine.
| Compound Name | 4-butyl-2,3-dimethylidenepyridine |
|---|---|
| PubChem CID | 123844863 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 4-butyl-2,3-dimethylidenepyridine |
| SMILES | C=c1nccc(CCCC)c1=C |
| InChI | InChI=1S/C11H15N/c1-4-5-6-11-7-8-12-10(3)9(11)2/h7-8H,2-6H2,1H3 |
| InChIKey | DNFSJHJVUDKZIR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |