C12H19Cl2NO3 — CID 123846000
[6-chloro-5-(1-chloroethylidene)-4-methoxyoct-6-en-3-yl] carbamate (PubChem CID 123846000) has the molecular formula C12H19Cl2NO3 and a molecular weight of 296.19 g/mol. Its IUPAC name is [6-chloro-5-(1-chloroethylidene)-4-methoxyoct-6-en-3-yl] carbamate.
| Compound Name | [6-chloro-5-(1-chloroethylidene)-4-methoxyoct-6-en-3-yl] carbamate |
|---|---|
| PubChem CID | 123846000 |
| Molecular Formula | C12H19Cl2NO3 |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [6-chloro-5-(1-chloroethylidene)-4-methoxyoct-6-en-3-yl] carbamate |
| SMILES | CC=C(Cl)C(=C(C)Cl)C(OC)C(CC)OC(N)=O |
| InChI | InChI=1S/C12H19Cl2NO3/c1-5-8(14)10(7(3)13)11(17-4)9(6-2)18-12(15)16/h5,9,11H,6H2,1-4H3,(H2,15,16) |
| InChIKey | BAFBMJQTKIOTOA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|