C16H27NO6 — CID 143232952
[(E)-3-acetyloxy-1-amino-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate (PubChem CID 143232952) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is [(E)-3-acetyloxy-1-amino-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate.
| Compound Name | [(E)-3-acetyloxy-1-amino-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate |
|---|---|
| PubChem CID | 143232952 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [(E)-3-acetyloxy-1-amino-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate |
| SMILES | CCC(C)/C=C/C(CC(OC(C)=O)C(OC)C(N)=O)OC(C)=O |
| InChI | InChI=1S/C16H27NO6/c1-6-10(2)7-8-13(22-11(3)18)9-14(23-12(4)19)15(21-5)16(17)20/h7-8,10,13-15H,6,9H2,1-5H3,(H2,17,20)/b8-7+ |
| InChIKey | LFUQDQLBOAQAIY-BQYQJAHWSA-N |
| XLogP | 1.34 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|