C9H12O2 — CID 11499246
[(E,3S)-hept-4-en-6-yn-3-yl] acetate (PubChem CID 11499246) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is [(E,3S)-hept-4-en-6-yn-3-yl] acetate.
| Compound Name | [(E,3S)-hept-4-en-6-yn-3-yl] acetate |
|---|---|
| PubChem CID | 11499246 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | [(E,3S)-hept-4-en-6-yn-3-yl] acetate |
| SMILES | C#C/C=C/[C@H](CC)OC(C)=O |
| InChI | InChI=1S/C9H12O2/c1-4-6-7-9(5-2)11-8(3)10/h1,6-7,9H,5H2,2-3H3/b7-6+/t9-/m0/s1 |
| InChIKey | PCGONVOPHSQNQK-UCUJLANTSA-N |
| XLogP | 1.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|