C20H30O3 — CID 10567585
[(E)-1-[2,2,4-trimethyl-3-(2-oxobut-3-enyl)cyclohex-3-en-1-yl]pent-1-en-3-yl] acetate (PubChem CID 10567585) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(E)-1-[2,2,4-trimethyl-3-(2-oxobut-3-enyl)cyclohex-3-en-1-yl]pent-1-en-3-yl] acetate.
| Compound Name | [(E)-1-[2,2,4-trimethyl-3-(2-oxobut-3-enyl)cyclohex-3-en-1-yl]pent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 10567585 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(E)-1-[2,2,4-trimethyl-3-(2-oxobut-3-enyl)cyclohex-3-en-1-yl]pent-1-en-3-yl] acetate |
| SMILES | C=CC(=O)CC1=C(C)CCC(/C=C/C(CC)OC(C)=O)C1(C)C |
| InChI | InChI=1S/C20H30O3/c1-7-17(22)13-19-14(3)9-10-16(20(19,5)6)11-12-18(8-2)23-15(4)21/h7,11-12,16,18H,1,8-10,13H2,2-6H3/b12-11+ |
| InChIKey | SKWGGWOEQQQBAN-VAWYXSNFSA-N |
| XLogP | 4.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|