C21H32O4 — CID 10926116
[(3E,7E)-9-hydroxy-7-methyl-1-(2,6,6-trimethyl-5-oxocyclohexen-1-yl)nona-3,7-dien-2-yl] acetate (PubChem CID 10926116) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [(3E,7E)-9-hydroxy-7-methyl-1-(2,6,6-trimethyl-5-oxocyclohexen-1-yl)nona-3,7-dien-2-yl] acetate.
| Compound Name | [(3E,7E)-9-hydroxy-7-methyl-1-(2,6,6-trimethyl-5-oxocyclohexen-1-yl)nona-3,7-dien-2-yl] acetate |
|---|---|
| PubChem CID | 10926116 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [(3E,7E)-9-hydroxy-7-methyl-1-(2,6,6-trimethyl-5-oxocyclohexen-1-yl)nona-3,7-dien-2-yl] acetate |
| SMILES | CC(=O)OC(/C=C/CC/C(C)=C/CO)CC1=C(C)CCC(=O)C1(C)C |
| InChI | InChI=1S/C21H32O4/c1-15(12-13-22)8-6-7-9-18(25-17(3)23)14-19-16(2)10-11-20(24)21(19,4)5/h7,9,12,18,22H,6,8,10-11,13-14H2,1-5H3/b9-7+,15-12+ |
| InChIKey | WJVJLEUGGKYIFU-KDFHGORWSA-N |
| XLogP | 4.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|