(6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid

C10H18O4S — CID 151449902

IUPAC(6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid
SMILESCC(=CCC/C(C)=C/CO)CS(=O)(=O)O
InChIInChI=1S/C10H18O4S/c1-9(6-7-11)4-3-5-10(2)8-15(12,13)14/h5-6,11H,3-4,7-8H2,1-2H3,(H,12,13,14)/b9-6+,10-5?
InChIKeyPGGWMYZQUFYIHM-YUSBAAHMSA-N
MW234.32 g/mol
LogP1.54
Rot. Bonds6

About (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid

(6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid (PubChem CID 151449902) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid.

Molecular Properties

Compound Name(6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid
PubChem CID151449902
Molecular FormulaC10H18O4S
Molecular Weight234.32 g/mol
Exact Mass234.09
IUPAC Name(6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid
SMILESCC(=CCC/C(C)=C/CO)CS(=O)(=O)O
InChIInChI=1S/C10H18O4S/c1-9(6-7-11)4-3-5-10(2)8-15(12,13)14/h5-6,11H,3-4,7-8H2,1-2H3,(H,12,13,14)/b9-6+,10-5?
InChIKeyPGGWMYZQUFYIHM-YUSBAAHMSA-N
XLogP1.54
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.32
LogP ≤ 51.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid?
The IUPAC name of (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid (CID 151449902) is (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid.
What is the SMILES notation for (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid?
The canonical SMILES for (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid is CC(=CCC/C(C)=C/CO)CS(=O)(=O)O.
What is the InChIKey of (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid?
The InChIKey is PGGWMYZQUFYIHM-YUSBAAHMSA-N. The full InChI is InChI=1S/C10H18O4S/c1-9(6-7-11)4-3-5-10(2)8-15(12,13)14/h5-6,11H,3-4,7-8H2,1-2H3,(H,12,13,14)/b9-6+,10-5?.
What are the key properties of (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid?
(6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid has a molecular weight of 234.32 g/mol, XLogP of 1.54, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-8-hydroxy-2,6-dimethylocta-2,6-diene-1-sulfonic acid is sourced from PubChem (CID 151449902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).