About 2-propyldec-7-enenitrile
2-propyldec-7-enenitrile (PubChem CID 123847297) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-propyldec-7-enenitrile.
Molecular Properties
| Compound Name | 2-propyldec-7-enenitrile |
| PubChem CID | 123847297 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-propyldec-7-enenitrile |
| SMILES | CCC=CCCCCC(C#N)CCC |
| InChI | InChI=1S/C13H23N/c1-3-5-6-7-8-9-11-13(12-14)10-4-2/h5-6,13H,3-4,7-11H2,1-2H3 |
| InChIKey | WYIYBHFETHLJMB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-propyldec-7-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyldec-7-enenitrile?
The IUPAC name of 2-propyldec-7-enenitrile (CID 123847297) is 2-propyldec-7-enenitrile.
What is the SMILES notation for 2-propyldec-7-enenitrile?
The canonical SMILES for 2-propyldec-7-enenitrile is CCC=CCCCCC(C#N)CCC.
What is the InChIKey of 2-propyldec-7-enenitrile?
The InChIKey is WYIYBHFETHLJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-3-5-6-7-8-9-11-13(12-14)10-4-2/h5-6,13H,3-4,7-11H2,1-2H3.
What are the key properties of 2-propyldec-7-enenitrile?
2-propyldec-7-enenitrile has a molecular weight of 193.33 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyldec-7-enenitrile is sourced from PubChem (CID 123847297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).